Chloroquine Phosphate
| Product ID: | ANW-43957 |  |
| Name: | Chloroquine Phosphate | |
| Synonyms: | ||
| CAS: | 50-63-5 | |
| MDL: | ||
| Formula: | C18H32ClN3O8P2 | |
| Formula Weight: | 515.862502 | |
| SMILES: | OP(=O)(O)O.OP(=O)(O)O.CCN(CCCC(Nc1ccnc2c1ccc(c2)Cl)C)CC | |
| EINECS: |
Pricing/Pack Size
| Pack Size | Purity | Price (USD) |
Chloroquine Phosphate Chemical Properties
| mp | 200 °C (dec.)(lit.) |
| storage temp. | Desiccate at RT |
| solubility | H2O: 50 mg/mL, clear |
| form | solid |
| Merck | 13,2182 |
| CAS DataBase Reference | 50-63-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)- N1,N1-diethyl-, phosphate (1:2)(50-63-5) |
Chloroquine Phosphate Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-40-20/21/22 |
| Safety Statements | 22-24/25-36 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | VB2450000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
Chloroquine Phosphate Usage and Synthesis
| Chemical Properties | White Solid |
| Usage | Standard anti-malarial drug. Substrate for MRP in multidrug resistant cell line and inhibits photoaffinity labelling of MRP by quinoline-based photoactive drug IAAQ |